C21H22ClN3O2S2 — CID 3395981
3-chloro-N-[[4-(diethylamino)phenyl]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 3395981) has the molecular formula C21H22ClN3O2S2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 3-chloro-N-[[4-(diethylamino)phenyl]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[4-(diethylamino)phenyl]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3395981 |
| Molecular Formula | C21H22ClN3O2S2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-chloro-N-[[4-(diethylamino)phenyl]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=S)NC(=O)c2sc3cc(OC)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O2S2/c1-4-25(5-2)14-8-6-13(7-9-14)23-21(28)24-20(26)19-18(22)16-11-10-15(27-3)12-17(16)29-19/h6-12H,4-5H2,1-3H3,(H2,23,24,26,28) |
| InChIKey | UXVWFIQKXFEKPZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|