C25H25ClN4O4S2 — CID 4514088
3-chloro-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 4514088) has the molecular formula C25H25ClN4O4S2 and a molecular weight of 545.09 g/mol. Its IUPAC name is 3-chloro-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4514088 |
| Molecular Formula | C25H25ClN4O4S2 |
| Molecular Weight | 545.09 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 3-chloro-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NC(=S)NNC(=O)c3ccc(NC(=O)C4CCCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C25H25ClN4O4S2/c1-34-17-11-12-18-19(13-17)36-21(20(18)26)24(33)28-25(35)30-29-23(32)15-7-9-16(10-8-15)27-22(31)14-5-3-2-4-6-14/h7-14H,2-6H2,1H3,(H,27,31)(H,29,32)(H2,28,30,33,35) |
| InChIKey | FNTRQDOLQPDRAP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|