C17H12ClFN2O2S2 — CID 3396055
3-chloro-N-[(4-fluorophenyl)carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 3396055) has the molecular formula C17H12ClFN2O2S2 and a molecular weight of 394.88 g/mol. Its IUPAC name is 3-chloro-N-[(4-fluorophenyl)carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(4-fluorophenyl)carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3396055 |
| Molecular Formula | C17H12ClFN2O2S2 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-chloro-N-[(4-fluorophenyl)carbamothioyl]-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NC(=S)Nc3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C17H12ClFN2O2S2/c1-23-11-6-7-12-13(8-11)25-15(14(12)18)16(22)21-17(24)20-10-4-2-9(19)3-5-10/h2-8H,1H3,(H2,20,21,22,24) |
| InChIKey | SHQGILJBVGOZFA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|