C19H17ClN2O2S2 — CID 17339980
3-chloro-N-[(4-propan-2-yloxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17339980) has the molecular formula C19H17ClN2O2S2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 3-chloro-N-[(4-propan-2-yloxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(4-propan-2-yloxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17339980 |
| Molecular Formula | C19H17ClN2O2S2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 3-chloro-N-[(4-propan-2-yloxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)Oc1ccc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S2/c1-11(2)24-13-9-7-12(8-10-13)21-19(25)22-18(23)17-16(20)14-5-3-4-6-15(14)26-17/h3-11H,1-2H3,(H2,21,22,23,25) |
| InChIKey | KCIKTMGRXRLNHX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|