C21H20ClN3O3S2 — CID 17169496
3-chloro-N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17169496) has the molecular formula C21H20ClN3O3S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is 3-chloro-N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17169496 |
| Molecular Formula | C21H20ClN3O3S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 3-chloro-N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(OC(C)C(=O)NNC(=S)NC(=O)c2sc3ccccc3c2Cl)cc1C |
| InChI | InChI=1S/C21H20ClN3O3S2/c1-11-8-9-14(10-12(11)2)28-13(3)19(26)24-25-21(29)23-20(27)18-17(22)15-6-4-5-7-16(15)30-18/h4-10,13H,1-3H3,(H,24,26)(H2,23,25,27,29) |
| InChIKey | HOORWTDMMMZGDL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|