C20H19ClN2O2S2 — CID 17160713
N-[(4-butan-2-yloxyphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 17160713) has the molecular formula C20H19ClN2O2S2 and a molecular weight of 418.97 g/mol. Its IUPAC name is N-[(4-butan-2-yloxyphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-butan-2-yloxyphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17160713 |
| Molecular Formula | C20H19ClN2O2S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[(4-butan-2-yloxyphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CCC(C)Oc1ccc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O2S2/c1-3-12(2)25-14-10-8-13(9-11-14)22-20(26)23-19(24)18-17(21)15-6-4-5-7-16(15)27-18/h4-12H,3H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | NQMGNODFINQGAW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|