C24H19ClN2O2S2 — CID 21041728
3-chloro-N-[[3-(1-phenylethoxy)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 21041728) has the molecular formula C24H19ClN2O2S2 and a molecular weight of 467.02 g/mol. Its IUPAC name is 3-chloro-N-[[3-(1-phenylethoxy)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[3-(1-phenylethoxy)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 21041728 |
| Molecular Formula | C24H19ClN2O2S2 |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 3-chloro-N-[[3-(1-phenylethoxy)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(Oc1cccc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O2S2/c1-15(16-8-3-2-4-9-16)29-18-11-7-10-17(14-18)26-24(30)27-23(28)22-21(25)19-12-5-6-13-20(19)31-22/h2-15H,1H3,(H2,26,27,28,30) |
| InChIKey | BVYFYYPZKKGLJP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|