C24H19ClN2O2S — CID 43877739
3-chloro-N-[3-(1-phenylethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 43877739) has the molecular formula C24H19ClN2O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is 3-chloro-N-[3-(1-phenylethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(1-phenylethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43877739 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 3-chloro-N-[3-(1-phenylethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)c2sc3ccccc3c2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O2S/c1-15(16-8-3-2-4-9-16)26-23(28)17-10-7-11-18(14-17)27-24(29)22-21(25)19-12-5-6-13-20(19)30-22/h2-15H,1H3,(H,26,28)(H,27,29) |
| InChIKey | HFKJUWVSJKJIJA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |