C17H12ClNO2S — CID 681064
N-(3-acetylphenyl)-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 681064) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 681064 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(3-acetylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C17H12ClNO2S/c1-10(20)11-5-4-6-12(9-11)19-17(21)16-15(18)13-7-2-3-8-14(13)22-16/h2-9H,1H3,(H,19,21) |
| InChIKey | DBBCURYPAUXJMP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |