C18H15ClN2O2S — CID 46761801
N-[3-[acetyl(methyl)amino]phenyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 46761801) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is N-[3-[acetyl(methyl)amino]phenyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[acetyl(methyl)amino]phenyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46761801 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[3-[acetyl(methyl)amino]phenyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=O)N(C)c1cccc(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O2S/c1-11(22)21(2)13-7-5-6-12(10-13)20-18(23)17-16(19)14-8-3-4-9-15(14)24-17/h3-10H,1-2H3,(H,20,23) |
| InChIKey | AXAZDWQRWJWTCU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |