C21H14ClNOS — CID 3128607
3-chloro-N-(4-phenylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 3128607) has the molecular formula C21H14ClNOS and a molecular weight of 363.87 g/mol. Its IUPAC name is 3-chloro-N-(4-phenylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(4-phenylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3128607 |
| Molecular Formula | C21H14ClNOS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-chloro-N-(4-phenylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H14ClNOS/c22-19-17-8-4-5-9-18(17)25-20(19)21(24)23-16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-13H,(H,23,24) |
| InChIKey | GLHNRRUDFJUQBU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |