C22H17ClN2O3S2 — CID 55428790
3-chloro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 55428790) has the molecular formula C22H17ClN2O3S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 3-chloro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55428790 |
| Molecular Formula | C22H17ClN2O3S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 3-chloro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)c3sc4ccccc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17ClN2O3S2/c1-14-6-12-17(13-7-14)30(27,28)25-16-10-8-15(9-11-16)24-22(26)21-20(23)18-4-2-3-5-19(18)29-21/h2-13,25H,1H3,(H,24,26) |
| InChIKey | MSYWYDNVXGCZAS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |