C17H14ClNO3S2 — CID 51319186
3-chloro-N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 51319186) has the molecular formula C17H14ClNO3S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-chloro-N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 51319186 |
| Molecular Formula | C17H14ClNO3S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-chloro-N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO3S2/c1-2-24(21,22)12-9-7-11(8-10-12)19-17(20)16-15(18)13-5-3-4-6-14(13)23-16/h3-10H,2H2,1H3,(H,19,20) |
| InChIKey | BTXQLABAADIVPP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |