C11H10ClNOS — CID 1080679
3-chloro-N-ethyl-1-benzothiophene-2-carboxamide (PubChem CID 1080679) has the molecular formula C11H10ClNOS and a molecular weight of 239.73 g/mol. Its IUPAC name is 3-chloro-N-ethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-ethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1080679 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 3-chloro-N-ethyl-1-benzothiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C11H10ClNOS/c1-2-13-11(14)10-9(12)7-5-3-4-6-8(7)15-10/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | JBNOXOJCFHIKOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |