C11H10ClNO2S — CID 18169005
3-chloro-N-ethoxy-1-benzothiophene-2-carboxamide (PubChem CID 18169005) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 3-chloro-N-ethoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-ethoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18169005 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 3-chloro-N-ethoxy-1-benzothiophene-2-carboxamide |
| SMILES | CCONC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C11H10ClNO2S/c1-2-15-13-11(14)10-9(12)7-5-3-4-6-8(7)16-10/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | WLJUJGZKPMLDFR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|