C13H12ClNO3S — CID 2166794
ethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (PubChem CID 2166794) has the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. Its IUPAC name is ethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 2166794 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | ethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H12ClNO3S/c1-2-18-10(16)7-15-13(17)12-11(14)8-5-3-4-6-9(8)19-12/h3-6H,2,7H2,1H3,(H,15,17) |
| InChIKey | DKLAGMCUHHUBRY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |