C18H12Cl2FNO3S — CID 42000511
(2-chloro-6-fluorophenyl)methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (PubChem CID 42000511) has the molecular formula C18H12Cl2FNO3S and a molecular weight of 412.27 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 42000511 |
| Molecular Formula | C18H12Cl2FNO3S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H12Cl2FNO3S/c19-12-5-3-6-13(21)11(12)9-25-15(23)8-22-18(24)17-16(20)10-4-1-2-7-14(10)26-17/h1-7H,8-9H2,(H,22,24) |
| InChIKey | LPHNPGNBVXPHNO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |