C19H16ClFN2O2S — CID 8643446
3-chloro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 8643446) has the molecular formula C19H16ClFN2O2S and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 8643446 |
| Molecular Formula | C19H16ClFN2O2S |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-chloro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)NCCc1ccccc1F |
| InChI | InChI=1S/C19H16ClFN2O2S/c20-17-13-6-2-4-8-15(13)26-18(17)19(25)23-11-16(24)22-10-9-12-5-1-3-7-14(12)21/h1-8H,9-11H2,(H,22,24)(H,23,25) |
| InChIKey | LDOKHQOJYTUPTM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |