C15H15ClN2O4S2 — CID 120526632
2-[2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 120526632) has the molecular formula C15H15ClN2O4S2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-[2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526632 |
| Molecular Formula | C15H15ClN2O4S2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)CNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C15H15ClN2O4S2/c16-13-9-3-1-2-4-10(9)24-14(13)15(22)18-7-11(19)17-5-6-23-8-12(20)21/h1-4H,5-8H2,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | SNFFWWINGCZHLC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|