C16H17ClN2O4S — CID 120534686
2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]pentanoic acid (PubChem CID 120534686) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120534686 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CNC(=O)c1sc2ccccc2c1Cl)C(=O)O |
| InChI | InChI=1S/C16H17ClN2O4S/c1-2-5-10(16(22)23)19-12(20)8-18-15(21)14-13(17)9-6-3-4-7-11(9)24-14/h3-4,6-7,10H,2,5,8H2,1H3,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | IJNXKNPXEDWTTM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |