C20H20ClN3O2S — CID 9303925
3-chloro-N-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 9303925) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 3-chloro-N-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 9303925 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-chloro-N-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)CNC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-24(2)14-9-7-13(8-10-14)11-22-17(25)12-23-20(26)19-18(21)15-5-3-4-6-16(15)27-19/h3-10H,11-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | RBVGBGQZIGTLCG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|