C16H19ClN4O2S — CID 9204862
3-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 9204862) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 9204862 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CN1CCN(NC(=O)CNC(=O)c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C16H19ClN4O2S/c1-20-6-8-21(9-7-20)19-13(22)10-18-16(23)15-14(17)11-4-2-3-5-12(11)24-15/h2-5H,6-10H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | IOEFYRQCRSOVFN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |