C13H12ClNO4S — CID 107833904
(2S)-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid (PubChem CID 107833904) has the molecular formula C13H12ClNO4S and a molecular weight of 313.76 g/mol. Its IUPAC name is (2S)-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107833904 |
| Molecular Formula | C13H12ClNO4S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (2S)-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCC[C@H](O)C(=O)O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H12ClNO4S/c14-10-7-3-1-2-4-9(7)20-11(10)12(17)15-6-5-8(16)13(18)19/h1-4,8,16H,5-6H2,(H,15,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | PRJRYCNGBTYINW-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |