C18H16ClNO2S — CID 95740862
3-chloro-N-[(3R)-3-hydroxy-3-phenylpropyl]-1-benzothiophene-2-carboxamide (PubChem CID 95740862) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is 3-chloro-N-[(3R)-3-hydroxy-3-phenylpropyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3R)-3-hydroxy-3-phenylpropyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95740862 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-chloro-N-[(3R)-3-hydroxy-3-phenylpropyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC[C@@H](O)c1ccccc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H16ClNO2S/c19-16-13-8-4-5-9-15(13)23-17(16)18(22)20-11-10-14(21)12-6-2-1-3-7-12/h1-9,14,21H,10-11H2,(H,20,22)/t14-/m1/s1 |
| InChIKey | GSXKDFPBTRBSQP-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |