C13H12ClNO4S — CID 103879219
methyl 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 103879219) has the molecular formula C13H12ClNO4S and a molecular weight of 313.76 g/mol. Its IUPAC name is methyl 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879219 |
| Molecular Formula | C13H12ClNO4S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H12ClNO4S/c1-19-13(18)8(16)6-15-12(17)11-10(14)7-4-2-3-5-9(7)20-11/h2-5,8,16H,6H2,1H3,(H,15,17) |
| InChIKey | QFYMHESVAAUHBG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |