C15H18Cl2N2OS — CID 18527249
3-chloro-N-(2-pyrrolidin-1-ium-1-ylethyl)-1-benzothiophene-2-carboxamide chloride (PubChem CID 18527249) has the molecular formula C15H18Cl2N2OS and a molecular weight of 345.30 g/mol. Its IUPAC name is 3-chloro-N-(2-pyrrolidin-1-ium-1-ylethyl)-1-benzothiophene-2-carboxamide chloride.
| Compound Name | 3-chloro-N-(2-pyrrolidin-1-ium-1-ylethyl)-1-benzothiophene-2-carboxamide chloride |
|---|---|
| PubChem CID | 18527249 |
| Molecular Formula | C15H18Cl2N2OS |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-chloro-N-(2-pyrrolidin-1-ium-1-ylethyl)-1-benzothiophene-2-carboxamide chloride |
| SMILES | O=C(NCC[NH+]1CCCC1)c1sc2ccccc2c1Cl.[Cl-] |
| InChI | InChI=1S/C15H17ClN2OS.ClH/c16-13-11-5-1-2-6-12(11)20-14(13)15(19)17-7-10-18-8-3-4-9-18;/h1-2,5-6H,3-4,7-10H2,(H,17,19);1H |
| InChIKey | HNYOFICTJFPUHB-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |