C21H22ClN2OS+ — CID 3677933
N-(1-benzylpiperidin-1-ium-4-yl)-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 3677933) has the molecular formula C21H22ClN2OS+ and a molecular weight of 385.94 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3677933 |
| Molecular Formula | C21H22ClN2OS+ |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CC[NH+](Cc2ccccc2)CC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H21ClN2OS/c22-19-17-8-4-5-9-18(17)26-20(19)21(25)23-16-10-12-24(13-11-16)14-15-6-2-1-3-7-15/h1-9,16H,10-14H2,(H,23,25)/p+1 |
| InChIKey | PVRUCJGLKWLKFV-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |