C16H18ClN3O2S — CID 2837015
1-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-cyclohexylurea (PubChem CID 2837015) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 1-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-cyclohexylurea.
| Compound Name | 1-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 2837015 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-cyclohexylurea |
| SMILES | O=C(NNC(=O)c1sc2ccccc2c1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C16H18ClN3O2S/c17-13-11-8-4-5-9-12(11)23-14(13)15(21)19-20-16(22)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,19,21)(H2,18,20,22) |
| InChIKey | FVBCXDXCXRHQBY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|