C13H9ClN2O4S — CID 2803219
4-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-oxobut-2-enoic acid (PubChem CID 2803219) has the molecular formula C13H9ClN2O4S and a molecular weight of 324.75 g/mol. Its IUPAC name is 4-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2803219 |
| Molecular Formula | C13H9ClN2O4S |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H9ClN2O4S/c14-11-7-3-1-2-4-8(7)21-12(11)13(20)16-15-9(17)5-6-10(18)19/h1-6H,(H,15,17)(H,16,20)(H,18,19) |
| InChIKey | RWJKCHWKTVOGPR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|