C23H17ClN2O3S — CID 4933136
3-chloro-N'-(4-phenylmethoxybenzoyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 4933136) has the molecular formula C23H17ClN2O3S and a molecular weight of 436.92 g/mol. Its IUPAC name is 3-chloro-N'-(4-phenylmethoxybenzoyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-(4-phenylmethoxybenzoyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4933136 |
| Molecular Formula | C23H17ClN2O3S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 3-chloro-N'-(4-phenylmethoxybenzoyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sc2ccccc2c1Cl)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H17ClN2O3S/c24-20-18-8-4-5-9-19(18)30-21(20)23(28)26-25-22(27)16-10-12-17(13-11-16)29-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,25,27)(H,26,28) |
| InChIKey | QQSHKSMSEWIJSH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|