C17H12ClN3O5S — CID 3510207
3-chloro-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 3510207) has the molecular formula C17H12ClN3O5S and a molecular weight of 405.82 g/mol. Its IUPAC name is 3-chloro-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3510207 |
| Molecular Formula | C17H12ClN3O5S |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 3-chloro-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H12ClN3O5S/c18-15-12-3-1-2-4-13(12)27-16(15)17(23)20-19-14(22)9-26-11-7-5-10(6-8-11)21(24)25/h1-8H,9H2,(H,19,22)(H,20,23) |
| InChIKey | WZWDTPZXNGMICR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|