C19H17ClN2O5S — CID 4033326
3-chloro-6-methoxy-N'-[2-(2-methoxyphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 4033326) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N'-[2-(2-methoxyphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-6-methoxy-N'-[2-(2-methoxyphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4033326 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 3-chloro-6-methoxy-N'-[2-(2-methoxyphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)COc3ccccc3OC)sc2c1 |
| InChI | InChI=1S/C19H17ClN2O5S/c1-25-11-7-8-12-15(9-11)28-18(17(12)20)19(24)22-21-16(23)10-27-14-6-4-3-5-13(14)26-2/h3-9H,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | VMKKYLCGPBRUHF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|