C18H14ClN3O6S — CID 1013795
3-chloro-6-methoxy-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 1013795) has the molecular formula C18H14ClN3O6S and a molecular weight of 435.85 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-6-methoxy-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 1013795 |
| Molecular Formula | C18H14ClN3O6S |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 3-chloro-6-methoxy-N'-[2-(4-nitrophenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)COc3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C18H14ClN3O6S/c1-27-12-6-7-13-14(8-12)29-17(16(13)19)18(24)21-20-15(23)9-28-11-4-2-10(3-5-11)22(25)26/h2-8H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | PKONTQYQFMXNOH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|