C18H18N4O7S — CID 3307651
2-(4-methoxyphenoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]acetamide (PubChem CID 3307651) has the molecular formula C18H18N4O7S and a molecular weight of 434.43 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3307651 |
| Molecular Formula | C18H18N4O7S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]acetamide |
| SMILES | COc1ccc(OCC(=O)NC(=S)NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H18N4O7S/c1-27-13-6-8-15(9-7-13)28-10-16(23)19-18(30)21-20-17(24)11-29-14-4-2-12(3-5-14)22(25)26/h2-9H,10-11H2,1H3,(H,20,24)(H2,19,21,23,30) |
| InChIKey | TUUSVRYTIHYHLC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|