C17H15BrN4O6S — CID 4509204
N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 4509204) has the molecular formula C17H15BrN4O6S and a molecular weight of 483.30 g/mol. Its IUPAC name is N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4509204 |
| Molecular Formula | C17H15BrN4O6S |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)NNC(=S)NC(=O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15BrN4O6S/c18-11-1-5-13(6-2-11)28-10-16(24)20-21-17(29)19-15(23)9-27-14-7-3-12(4-8-14)22(25)26/h1-8H,9-10H2,(H,20,24)(H2,19,21,23,29) |
| InChIKey | AHVUXNKJMBQGEL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|