C19H17Cl2N5O6S — CID 4509200
N-(2,4-dichlorophenyl)-4-[2-[[2-(4-nitrophenoxy)acetyl]carbamothioyl]hydrazinyl]-4-oxobutanamide (PubChem CID 4509200) has the molecular formula C19H17Cl2N5O6S and a molecular weight of 514.35 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[2-[[2-(4-nitrophenoxy)acetyl]carbamothioyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[2-[[2-(4-nitrophenoxy)acetyl]carbamothioyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4509200 |
| Molecular Formula | C19H17Cl2N5O6S |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[2-[[2-(4-nitrophenoxy)acetyl]carbamothioyl]hydrazinyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)NNC(=S)NC(=O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17Cl2N5O6S/c20-11-1-6-15(14(21)9-11)22-16(27)7-8-17(28)24-25-19(33)23-18(29)10-32-13-4-2-12(3-5-13)26(30)31/h1-6,9H,7-8,10H2,(H,22,27)(H,24,28)(H2,23,25,29,33) |
| InChIKey | WICFHORRGOJJBE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|