C15H13N5O5S — CID 4508872
2-(4-nitrophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide (PubChem CID 4508872) has the molecular formula C15H13N5O5S and a molecular weight of 375.37 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4508872 |
| Molecular Formula | C15H13N5O5S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C15H13N5O5S/c21-13(9-25-12-3-1-11(2-4-12)20(23)24)17-15(26)19-18-14(22)10-5-7-16-8-6-10/h1-8H,9H2,(H,18,22)(H2,17,19,21,26) |
| InChIKey | DPHWPMXKNKIHEZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|