C18H13ClN4O5S2 — CID 4509036
N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 4509036) has the molecular formula C18H13ClN4O5S2 and a molecular weight of 464.91 g/mol. Its IUPAC name is N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4509036 |
| Molecular Formula | C18H13ClN4O5S2 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H13ClN4O5S2/c19-15-12-3-1-2-4-13(12)30-16(15)17(25)21-22-18(29)20-14(24)9-28-11-7-5-10(6-8-11)23(26)27/h1-8H,9H2,(H,21,25)(H2,20,22,24,29) |
| InChIKey | RANFZMPZSIQNFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|