C17H12ClN3O4S — CID 6018443
3-chloro-6-methoxy-N-[(Z)-(3-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6018443) has the molecular formula C17H12ClN3O4S and a molecular weight of 389.82 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N-[(Z)-(3-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methoxy-N-[(Z)-(3-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6018443 |
| Molecular Formula | C17H12ClN3O4S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 3-chloro-6-methoxy-N-[(Z)-(3-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)N/N=C\c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C17H12ClN3O4S/c1-25-12-5-6-13-14(8-12)26-16(15(13)18)17(22)20-19-9-10-3-2-4-11(7-10)21(23)24/h2-9H,1H3,(H,20,22)/b19-9- |
| InChIKey | SXSRJSHFYKOODZ-OCKHKDLRSA-N |
| XLogP | 4.24 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|