C17H12Cl2N2OS — CID 4150513
3-chloro-N-[(3-chlorophenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 4150513) has the molecular formula C17H12Cl2N2OS and a molecular weight of 363.27 g/mol. Its IUPAC name is 3-chloro-N-[(3-chlorophenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3-chlorophenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4150513 |
| Molecular Formula | C17H12Cl2N2OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 3-chloro-N-[(3-chlorophenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)NN=Cc3cccc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C17H12Cl2N2OS/c1-10-5-6-13-14(7-10)23-16(15(13)19)17(22)21-20-9-11-3-2-4-12(18)8-11/h2-9H,1H3,(H,21,22) |
| InChIKey | ITJYMFSGWBWSLZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|