C16H10ClFN2OS — CID 5011440
3-chloro-N-[(3-fluorophenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 5011440) has the molecular formula C16H10ClFN2OS and a molecular weight of 332.79 g/mol. Its IUPAC name is 3-chloro-N-[(3-fluorophenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3-fluorophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5011440 |
| Molecular Formula | C16H10ClFN2OS |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-chloro-N-[(3-fluorophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1cccc(F)c1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H10ClFN2OS/c17-14-12-6-1-2-7-13(12)22-15(14)16(21)20-19-9-10-4-3-5-11(18)8-10/h1-9H,(H,20,21) |
| InChIKey | CYCALCYCNYDHFZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|