C22H14Cl2N2O2S — CID 11037566
3,5-dichloro-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 11037566) has the molecular formula C22H14Cl2N2O2S and a molecular weight of 441.34 g/mol. Its IUPAC name is 3,5-dichloro-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11037566 |
| Molecular Formula | C22H14Cl2N2O2S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 3,5-dichloro-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Oc2ccccc2)c1)c1sc2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C22H14Cl2N2O2S/c23-15-9-10-19-18(12-15)20(24)21(29-19)22(27)26-25-13-14-5-4-8-17(11-14)28-16-6-2-1-3-7-16/h1-13H,(H,26,27)/b25-13+ |
| InChIKey | YXCGVXYKDXLPGS-DHRITJCHSA-N |
| XLogP | 6.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|