C16H9Cl2N3O3S — CID 11741322
3,5-dichloro-N-[(E)-(2-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 11741322) has the molecular formula C16H9Cl2N3O3S and a molecular weight of 394.24 g/mol. Its IUPAC name is 3,5-dichloro-N-[(E)-(2-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[(E)-(2-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11741322 |
| Molecular Formula | C16H9Cl2N3O3S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 3,5-dichloro-N-[(E)-(2-nitrophenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1[N+](=O)[O-])c1sc2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C16H9Cl2N3O3S/c17-10-5-6-13-11(7-10)14(18)15(25-13)16(22)20-19-8-9-3-1-2-4-12(9)21(23)24/h1-8H,(H,20,22)/b19-8+ |
| InChIKey | LJLGVWMFOCMRBY-UFWORHAWSA-N |
| XLogP | 4.88 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|