C16H10Cl2N4O3S2 — CID 11189914
1-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]-3-(2-nitrophenyl)thiourea (PubChem CID 11189914) has the molecular formula C16H10Cl2N4O3S2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 1-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]-3-(2-nitrophenyl)thiourea.
| Compound Name | 1-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]-3-(2-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 11189914 |
| Molecular Formula | C16H10Cl2N4O3S2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | 1-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]-3-(2-nitrophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1[N+](=O)[O-])c1sc2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C16H10Cl2N4O3S2/c17-8-5-6-12-9(7-8)13(18)14(27-12)15(23)20-21-16(26)19-10-3-1-2-4-11(10)22(24)25/h1-7H,(H,20,23)(H2,19,21,26) |
| InChIKey | OCDLRXACRDZMLL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|