C14H12ClN5O2S2 — CID 8618828
1-(4-chlorophenyl)-3-[(2-nitrophenyl)carbamothioylamino]thiourea (PubChem CID 8618828) has the molecular formula C14H12ClN5O2S2 and a molecular weight of 381.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2-nitrophenyl)carbamothioylamino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2-nitrophenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8618828 |
| Molecular Formula | C14H12ClN5O2S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2-nitrophenyl)carbamothioylamino]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1NC(=S)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN5O2S2/c15-9-5-7-10(8-6-9)16-13(23)18-19-14(24)17-11-3-1-2-4-12(11)20(21)22/h1-8H,(H2,16,18,23)(H2,17,19,24) |
| InChIKey | IIBNWUPFMZUNLC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|