C16H11ClN4O3 — CID 108860649
(Z)-N-(4-chlorophenyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide (PubChem CID 108860649) has the molecular formula C16H11ClN4O3 and a molecular weight of 342.74 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108860649 |
| Molecular Formula | C16H11ClN4O3 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClN4O3/c17-12-5-7-13(8-6-12)20-16(22)11(9-18)10-19-14-3-1-2-4-15(14)21(23)24/h1-8,10,19H,(H,20,22)/b11-10- |
| InChIKey | DLDCLSPEQSLAGI-KHPPLWFESA-N |
| XLogP | 3.71 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|