C16H13N5O3 — CID 108816772
(Z)-2-cyano-3-[(6-methyl-3-pyridinyl)amino]-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 108816772) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(6-methyl-3-pyridinyl)amino]-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(6-methyl-3-pyridinyl)amino]-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108816772 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (Z)-2-cyano-3-[(6-methyl-3-pyridinyl)amino]-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(N/C=C(/C#N)C(=O)Nc2ccccc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H13N5O3/c1-11-6-7-13(10-18-11)19-9-12(8-17)16(22)20-14-4-2-3-5-15(14)21(23)24/h2-7,9-10,19H,1H3,(H,20,22)/b12-9- |
| InChIKey | PDLKJNRPOHEHRK-XFXZXTDPSA-N |
| XLogP | 2.76 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|