C16H12Cl2N4O — CID 108829065
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide (PubChem CID 108829065) has the molecular formula C16H12Cl2N4O and a molecular weight of 347.21 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108829065 |
| Molecular Formula | C16H12Cl2N4O |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide |
| SMILES | Cc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C16H12Cl2N4O/c1-10-2-4-13(9-20-10)21-8-11(7-19)16(23)22-15-5-3-12(17)6-14(15)18/h2-6,8-9,21H,1H3,(H,22,23)/b11-8- |
| InChIKey | FTJGSMWCOAWSFI-FLIBITNWSA-N |
| XLogP | 4.15 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|