C20H20Cl2N4O — CID 108828963
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)anilino]prop-2-enamide (PubChem CID 108828963) has the molecular formula C20H20Cl2N4O and a molecular weight of 403.31 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108828963 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)anilino]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N4O/c1-3-26(4-2)17-8-6-16(7-9-17)24-13-14(12-23)20(27)25-19-10-5-15(21)11-18(19)22/h5-11,13,24H,3-4H2,1-2H3,(H,25,27)/b14-13- |
| InChIKey | KVZFZFHORDJVFL-YPKPFQOOSA-N |
| XLogP | 5.30 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|