C21H22Cl3N4O- — CID 108829006
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylanilino]prop-2-enamide chloride (PubChem CID 108829006) has the molecular formula C21H22Cl3N4O- and a molecular weight of 452.79 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylanilino]prop-2-enamide chloride.
| Compound Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylanilino]prop-2-enamide chloride |
|---|---|
| PubChem CID | 108829006 |
| Molecular Formula | C21H22Cl3N4O- |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylanilino]prop-2-enamide chloride |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2Cl)c(C)c1.[Cl-] |
| InChI | InChI=1S/C21H22Cl2N4O.ClH/c1-4-27(5-2)17-7-9-19(14(3)10-17)25-13-15(12-24)21(28)26-20-8-6-16(22)11-18(20)23;/h6-11,13,25H,4-5H2,1-3H3,(H,26,28);1H/p-1/b15-13-; |
| InChIKey | UIUKBJJFOVMQRQ-ZDCVYKBASA-M |
| XLogP | 2.61 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|